Products Categories
| CAS No.: | 161841-12-9 |
|---|---|
| Name: | 2-Propenoic acid,6-(4-hydroxyphenoxy)hexyl ester |
| Article Data: | 15 |
| Cas Database | |
| Molecular Structure: | |
|
|
|
| Formula: | C15H20O4 |
| Molecular Weight: | 264.321 |
| Synonyms: | 4-[6-(Acryloyloxy)hexyloxy]phenol;6-(4-Hydroxyphenoxy)hexyl prop-2-enoate; |
| EINECS: | N/A |
| Density: | 1.09 g/cm3 |
| Melting Point: | 55℃ (water ) |
| Boiling Point: | 407.6 °C at 760 mmHg |
| Flash Point: | 147 °C |
| Solubility: | N/A |
| Appearance: | N/A |
| Hazard Symbols: | N/A |
| Risk Codes: | N/A |
| Safety: | |
| Transport Information: | N/A |
| PSA: | 55.76000 |
| LogP: | 3.06060 |
Please post your buying leads,so that our qualified suppliers will soon
contact you!
*Required Fields
The 2-Propenoic acid,6-(4-hydroxyphenoxy)hexyl ester, with the CAS registry number 161841-12-9, is also known as 4-((6-(Acryloyloxy)hexyl)oxy)phenol. This chemical's molecular formula is C15H20O4 and molecular weight is 264.32. What's more, its systematic name is 6-(4-Hydroxyphenoxy)hexyl prop-2-enoate.
Physical properties of 2-Propenoic acid,6-(4-hydroxyphenoxy)hexyl ester are: (1)ACD/LogP: ; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.47; (4)ACD/LogD (pH 7.4): 3.47; (5)ACD/BCF (pH 5.5): 256.54; (6)ACD/BCF (pH 7.4): 256.24; (7)ACD/KOC (pH 5.5): 1845.35; (8)ACD/KOC (pH 7.4): 1843.21; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 11; (12)Polar Surface Area: 55.76 Å2; (13)Index of Refraction: 1.517; (14)Molar Refractivity: 73.37 cm3; (15)Molar Volume: 242.4 cm3; (16)Polarizability: 29.08×10-24 cm3; (17)Surface Tension: 40.2 dyne/cm; (18)Density: 1.09 g/cm3; (19)Flash Point: 147 °C; (20)Enthalpy of Vaporization: 68.51 kJ/mol; (21)Boiling Point: 407.6 °C at 760 mmHg; (22)Vapour Pressure: 3.17E-07 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: C=CC(=O)OCCCCCCOc1ccc(O)cc1
(2)InChI: InChI=1S/C15H20O4/c1-2-15(17)19-12-6-4-3-5-11-18-14-9-7-13(16)8-10-14/h2,7-10,16H,1,3-6,11-12H2
(3)InChIKey: VWDSGKYABCFREO-UHFFFAOYSA-N
