Products Categories
| CAS No.: | 216581-76-9 |
|---|---|
| Name: | 1,3-Adamantanediol monoacrylate |
| Article Data: | 5 |
| Cas Database | |
| Molecular Structure: | |
|
|
|
| Formula: | C13H18O3 |
| Molecular Weight: | 222.284 |
| Synonyms: | 1,3-Adamantanediolmonoacrylate;1-Acryloyloxy-3-adamantanol;1-Acryloyloxy-3-hydroxyadamantane;3-Hydroxy-1-adamantyl acrylate;Adamantate HA;3-Hydroxyadamantan-1-yl acrylate; |
| EINECS: | N/A |
| Density: | 1.201 g/cm3 |
| Melting Point: | 70.0 to 74.0 °C |
| Boiling Point: | 314.249 °C at 760 mmHg |
| Flash Point: | 128.115 °C |
| Solubility: | N/A |
| Appearance: | N/A |
| Hazard Symbols: | N/A |
| Risk Codes: | N/A |
| Safety: | |
| Transport Information: | N/A |
| PSA: | 46.53000 |
| LogP: | 1.79930 |
Please post your buying leads,so that our qualified suppliers will soon
contact you!
*Required Fields
The 1,3-Adamantanediol monoacrylate, with the CAS registry number 216581-76-9, is also known as 1-Acryloyloxy-3-hydroxyadamantane. This chemical's molecular formula is C13H18O3 and molecular weight is 222.28. What's more, its systematic name is 3-Hydroxyadamantan-1-yl acrylate. Its classification code is TSCA Flag P [A commenced PMN (Premanufacture Notice) substance].
Physical properties of 1,3-Adamantanediol monoacrylate are: (1)ACD/LogP: 1.775; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.78; (4)ACD/LogD (pH 7.4): 1.78; (5)ACD/BCF (pH 5.5): 13.14; (6)ACD/BCF (pH 7.4): 13.14; (7)ACD/KOC (pH 5.5): 219.95; (8)ACD/KOC (pH 7.4): 219.95; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 46.53 Å2; (13)Index of Refraction: 1.553; (14)Molar Refractivity: 59.244 cm3; (15)Molar Volume: 185.1 cm3; (16)Polarizability: 23.486×10-24cm3; (17)Surface Tension: 46.1269989013672 dyne/cm; (18)Density: 1.201 g/cm3; (19)Flash Point: 128.115 °C; (20)Enthalpy of Vaporization: 64.393 kJ/mol; (21)Boiling Point: 314.249 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: C=CC(=O)OC13CC2CC(O)(CC(C1)C2)C3
(2)Std. InChI: InChI=1S/C13H18O3/c1-2-11(14)16-13-6-9-3-10(7-13)5-12(15,4-9)8-13/h2,9-10,15H,1,3-8H2
(3)Std. InChIKey: DKDKCSYKDZNMMA-UHFFFAOYSA-N
