Products Categories
| CAS No.: | 55906-42-8 |
|---|---|
| Name: | 1,3,4-Thiadiazolidine-2,5-dithione,sodium salt (1:2) |
| Molecular Structure: | |
|
|
|
| Formula: | C2H2N2Na2S3 |
| Molecular Weight: | 196.21 |
| Synonyms: | 1,3,4-Thiadiazole-2,5-dithiol,disodium deriv. (6CI);1,3,4-Thiadiazolidine-2,5-dithione, disodium salt (9CI);2,5-Dimercapto-1,3,4-thiadiazole disodium salt;DMDT disodium salt;Disodium1,3,4-thiadiazole-2,5-dithiolate; |
| EINECS: | 259-886-4 |
| Density: | N/A |
| Melting Point: | N/A |
| Boiling Point: | 259.6oC at 760mmHg |
| Flash Point: | 110.8oC |
| Solubility: | N/A |
| Appearance: | N/A |
| Hazard Symbols: | N/A |
| Risk Codes: | N/A |
| Safety: | |
| Transport Information: | N/A |
| PSA: | 102.28000 |
| LogP: | 1.43490 |
Please post your buying leads,so that our qualified suppliers will soon
contact you!
*Required Fields
The CAS register number of Disodium 1,3,4-thiadiazole-2,5-dithiolate is 55906-42-8. It also can be called as 1,3,4-Thiadiazolidine-2,5-dithione, sodium salt (1:2) and the systematic name about this chemical is 1,3,4-thiadiazole-2,5-dithiol, disodium salt. The molecular formula about this chemical is C2H2N2Na2S3 and the molecular weight is 196.21.
You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].[Na+].Sc1nnc(S)s1
(2)InChI: InChI=1/C2H2N2S3.2Na/c5-1-3-4-2(6)7-1;;/h(H,3,5)(H,4,6);;/q;2*+1
(3)InChIKey: YCVGBTRTVKMLSH-UHFFFAOYAD
(4)Std. InChI: InChI=1S/C2H2N2S3.2Na/c5-1-3-4-2(6)7-1;;/h(H,3,5)(H,4,6);;/q;2*+1
(5)Std. InChIKey: YCVGBTRTVKMLSH-UHFFFAOYSA-N
