Products Categories
| CAS No.: | 65202-07-5 |
|---|---|
| Name: | Ethanamine,2-(3,4-dichlorophenoxy)-N,N-diethyl- |
| Article Data: | 2 |
| Cas Database | |
| Molecular Structure: | |
|
|
|
| Formula: | C12H17Cl2NO |
| Molecular Weight: | 262.179 |
| Synonyms: | 2-(3,4-Dichlorophenoxy)triethylamine;DCPTA;Photosynthogen;SC 0046; |
| EINECS: | N/A |
| Density: | 1.154 g/cm3 |
| Melting Point: | N/A |
| Boiling Point: | 332.9 °C at 760 mmHg |
| Flash Point: | 155.1 °C |
| Solubility: | N/A |
| Appearance: | N/A |
| Hazard Symbols: | N/A |
| Risk Codes: | N/A |
| Safety: | |
| Transport Information: | N/A |
| PSA: | 12.47000 |
| LogP: | 3.71400 |
Please post your buying leads,so that our qualified suppliers will soon
contact you!
*Required Fields
The Guayule with the cas number 65202-07-5 is also called Ethanamine,2-(3,4-dichlorophenoxy)-N,N-diethyl-. Both the systematic name and IUPAC name are 2-(3,4-dichlorophenoxy)-N,N-diethylethanamine. Its molecular formula is C12H17Cl2NO. This chemical is a kind of organics. It should be stored in dry and cool environment.
The properties of the chemical are: (1)ACD/LogP: 4.44; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 6; (6)Polar Surface Area: 12.47 Å2; (7)Index of Refraction: 1.525; (8)Molar Refractivity: 69.6 cm3; (9)Molar Volume: 227.1 cm3; (10)Polarizability: 27.59×10-24cm3; (11)Surface Tension: 37 dyne/cm; (12)Enthalpy of Vaporization: 57.57 kJ/mol; (13)Vapour Pressure: 0.000141 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Clc1ccc(OCCN(CC)CC)cc1Cl
(2)InChI: InChI=1/C12H17Cl2NO/c1-3-15(4-2)7-8-16-10-5-6-11(13)12(14)9-10/h5-6,9H,3-4,7-8H2,1-2H3
(3)InChIKey: LOVYCUYJRWLTSU-UHFFFAOYAF
