The Carbamic acid,butylphenyl-, ethyl ester (9CI), with the CAS registry number 2621-75-2, is also known as Ethyl N-n-butyl-N-phenylcarbamate. This chemical's molecular formula is C₁₃H₁₉NO₂ and molecular weight is 221.2955. Its IUPAC name is called ethyl N-butyl-N-phenylcarbamate.

Physical properties of Carbamic acid,butylphenyl-, ethyl ester (9CI): (1)ACD/LogP: 4.21; (2)#H bond acceptors: 3; (3)#Freely Rotating Bonds: 6; (4)Index of Refraction: 1.525; (5)Molar Refractivity: 65.5 cm³; (6)Molar Volume: 213.4 cm³; (7)Surface Tension: 38.8 dyne/cm; (8)Density: 1.036 g/cm³; (9)Flash Point: 136 °C; (10)Enthalpy of Vaporization: 54.13 kJ/mol; (11)Boiling Point: 301.2 °C at 760 mmHg; (12)Vapour Pressure: 0.00107 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCN(C1=CC=CC=C1)C(=O)OCC
(2)InChI: InChI=1S/C13H19NO2/c1-3-5-11-14(13(15)16-4-2)12-9-7-6-8-10-12/h6-10H,3-5,11H2,1-2H3
(3)InChIKey: DYDBYWYPNAKHNO-UHFFFAOYSA-N