The Diphenylammonium sodium sulphite, with the CAS registry number 37625-49-3, is also known as N-Phenylanilinium sodium sulfite (1:1:1). Its EINECS registry number is 253-572-0. This chemical's molecular formula is C₁₂H₁₂NNaO₃S and molecular weight is 273.28335. What's more, both its IUPAC name and systematic name are the same which is called Sodium diphenylammonium sulfite.

Physical properties about Diphenylammonium sodium sulphite are: (1)#H bond acceptors: 4; (2)#H bond donors: 3; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 99.01 Å².

You can still convert the following datas into molecular structure:
(1) SMILES: [Na+].[O-]S([O-])=O.c1ccccc1[NH2+]c2ccccc2
(2) InChI: InChI=1/C12H11N.Na.H2O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;1-4(2)3/h1-10,13H;;(H2,1,2,3)/q;+1;/p-1
(3) InChIKey: IPVOGZPLQLHPIG-REWHXWOFAX